C33H51N2O6PS2 — CID 118689805
4-methyl-3-[(2-methylphenyl)-(2-methyl-5-sulfonatophenyl)phosphanyl]benzenesulfonate;bis(triethylazanium) (PubChem CID 118689805) has the molecular formula C33H51N2O6PS2 and a molecular weight of 666.89 g/mol. Its IUPAC name is 4-methyl-3-[(2-methylphenyl)-(2-methyl-5-sulfonatophenyl)phosphanyl]benzenesulfonate;bis(triethylazanium).
| Compound Name | 4-methyl-3-[(2-methylphenyl)-(2-methyl-5-sulfonatophenyl)phosphanyl]benzenesulfonate;bis(triethylazanium) |
|---|---|
| PubChem CID | 118689805 |
| Molecular Formula | C33H51N2O6PS2 |
| Molecular Weight | 666.89 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | 4-methyl-3-[(2-methylphenyl)-(2-methyl-5-sulfonatophenyl)phosphanyl]benzenesulfonate;bis(triethylazanium) |
| SMILES | CC[NH+](CC)CC.CC[NH+](CC)CC.Cc1ccccc1P(c1cc(S(=O)(=O)[O-])ccc1C)c1cc(S(=O)(=O)[O-])ccc1C |
| InChI | InChI=1S/C21H21O6PS2.2C6H15N/c1-14-6-4-5-7-19(14)28(20-12-17(29(22,23)24)10-8-15(20)2)21-13-18(30(25,26)27)11-9-16(21)3;2*1-4-7(5-2)6-3/h4-13H,1-3H3,(H,22,23,24)(H,25,26,27);2*4-6H2,1-3H3 |
| InChIKey | PAKULLQNVVUGOM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.89 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|