C11H18O4 — CID 11053011
(2S,3R)-2-[(1R)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol (PubChem CID 11053011) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (2S,3R)-2-[(1R)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol.
| Compound Name | (2S,3R)-2-[(1R)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol |
|---|---|
| PubChem CID | 11053011 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (2S,3R)-2-[(1R)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol |
| SMILES | C#CC[C@@H](O)[C@H](CO)[C@@H](C=C)OCOC |
| InChI | InChI=1S/C11H18O4/c1-4-6-10(13)9(7-12)11(5-2)15-8-14-3/h1,5,9-13H,2,6-8H2,3H3/t9-,10+,11+/m0/s1 |
| InChIKey | WSRQNCHAEFZKGK-HBNTYKKESA-N |
| XLogP | 0.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|