C16H26O5 — CID 87486904
[(2R,3R)-3-hydroxy-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-ynyl] 2,2-dimethylpropanoate (PubChem CID 87486904) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is [(2R,3R)-3-hydroxy-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R)-3-hydroxy-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87486904 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(2R,3R)-3-hydroxy-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-ynyl] 2,2-dimethylpropanoate |
| SMILES | C#CC[C@@H](O)[C@@H](COC(=O)C(C)(C)C)[C@H](C=C)OCOC |
| InChI | InChI=1S/C16H26O5/c1-7-9-13(17)12(14(8-2)21-11-19-6)10-20-15(18)16(3,4)5/h1,8,12-14,17H,2,9-11H2,3-6H3/t12-,13-,14+/m1/s1 |
| InChIKey | YSDXUZSDEJYULL-MCIONIFRSA-N |
| XLogP | 1.75 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|