C23H29Cl2NO2 — CID 110531194
1-benzyl-3-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methyl]piperidin-4-ol (PubChem CID 110531194) has the molecular formula C23H29Cl2NO2 and a molecular weight of 422.40 g/mol. Its IUPAC name is 1-benzyl-3-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methyl]piperidin-4-ol.
| Compound Name | 1-benzyl-3-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 110531194 |
| Molecular Formula | C23H29Cl2NO2 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-benzyl-3-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methyl]piperidin-4-ol |
| SMILES | CC(C)COc1c(Cl)cc(CC2CN(Cc3ccccc3)CCC2O)cc1Cl |
| InChI | InChI=1S/C23H29Cl2NO2/c1-16(2)15-28-23-20(24)11-18(12-21(23)25)10-19-14-26(9-8-22(19)27)13-17-6-4-3-5-7-17/h3-7,11-12,16,19,22,27H,8-10,13-15H2,1-2H3 |
| InChIKey | NBWNTHZJITZQLR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |