C21H25Cl2NO3 — CID 110531863
1-benzyl-3-[(3,5-dichloro-2,4-dimethoxyphenyl)methyl]piperidin-4-ol (PubChem CID 110531863) has the molecular formula C21H25Cl2NO3 and a molecular weight of 410.34 g/mol. Its IUPAC name is 1-benzyl-3-[(3,5-dichloro-2,4-dimethoxyphenyl)methyl]piperidin-4-ol.
| Compound Name | 1-benzyl-3-[(3,5-dichloro-2,4-dimethoxyphenyl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 110531863 |
| Molecular Formula | C21H25Cl2NO3 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-benzyl-3-[(3,5-dichloro-2,4-dimethoxyphenyl)methyl]piperidin-4-ol |
| SMILES | COc1c(Cl)cc(CC2CN(Cc3ccccc3)CCC2O)c(OC)c1Cl |
| InChI | InChI=1S/C21H25Cl2NO3/c1-26-20-15(11-17(22)21(27-2)19(20)23)10-16-13-24(9-8-18(16)25)12-14-6-4-3-5-7-14/h3-7,11,16,18,25H,8-10,12-13H2,1-2H3 |
| InChIKey | FCLPJFOOYSJJNI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |