C12H16O4 — CID 11053295
(3aR,8aS,8bS)-2,2,3a-trimethyl-8a,8b-dihydro-4H-furo[2,3-e][1,3]benzodioxol-6-one (PubChem CID 11053295) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3aR,8aS,8bS)-2,2,3a-trimethyl-8a,8b-dihydro-4H-furo[2,3-e][1,3]benzodioxol-6-one.
| Compound Name | (3aR,8aS,8bS)-2,2,3a-trimethyl-8a,8b-dihydro-4H-furo[2,3-e][1,3]benzodioxol-6-one |
|---|---|
| PubChem CID | 11053295 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (3aR,8aS,8bS)-2,2,3a-trimethyl-8a,8b-dihydro-4H-furo[2,3-e][1,3]benzodioxol-6-one |
| SMILES | CC1(C)O[C@H]2[C@H]3OCC(=O)C3=CC[C@@]2(C)O1 |
| InChI | InChI=1S/C12H16O4/c1-11(2)15-10-9-7(8(13)6-14-9)4-5-12(10,3)16-11/h4,9-10H,5-6H2,1-3H3/t9-,10-,12+/m0/s1 |
| InChIKey | PLPLMOWUCMPYNJ-JBLDHEPKSA-N |
| XLogP | 1.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |