C23H24N4S — CID 110533181
4-(2,4-dimethylphenyl)-N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 110533181) has the molecular formula C23H24N4S and a molecular weight of 388.54 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dimethylphenyl)-N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110533181 |
| Molecular Formula | C23H24N4S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | CCn1c(C)c(/C=N\Nc2nc(-c3ccc(C)cc3C)cs2)c2ccccc21 |
| InChI | InChI=1S/C23H24N4S/c1-5-27-17(4)20(19-8-6-7-9-22(19)27)13-24-26-23-25-21(14-28-23)18-11-10-15(2)12-16(18)3/h6-14H,5H2,1-4H3,(H,25,26)/b24-13- |
| InChIKey | SPOCIWYRFXNAIT-CFRMEGHHSA-N |
| XLogP | 6.16 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|