C14H14OSSi — CID 11054361
(E)-1-thiophen-2-yl-7-trimethylsilylhept-1-en-4,6-diyn-3-one (PubChem CID 11054361) has the molecular formula C14H14OSSi and a molecular weight of 258.42 g/mol. Its IUPAC name is (E)-1-thiophen-2-yl-7-trimethylsilylhept-1-en-4,6-diyn-3-one.
| Compound Name | (E)-1-thiophen-2-yl-7-trimethylsilylhept-1-en-4,6-diyn-3-one |
|---|---|
| PubChem CID | 11054361 |
| Molecular Formula | C14H14OSSi |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (E)-1-thiophen-2-yl-7-trimethylsilylhept-1-en-4,6-diyn-3-one |
| SMILES | C[Si](C)(C)C#CC#CC(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C14H14OSSi/c1-17(2,3)12-5-4-7-13(15)9-10-14-8-6-11-16-14/h6,8-11H,1-3H3/b10-9+ |
| InChIKey | LISVEXJVVUKOIG-MDZDMXLPSA-N |
| XLogP | 3.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|