C28H35N3O2 — CID 110548295
1-[4-(diethylamino)phenyl]-3-(3,4-dimethylphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione (PubChem CID 110548295) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-3-(3,4-dimethylphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-[4-(diethylamino)phenyl]-3-(3,4-dimethylphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110548295 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-3-(3,4-dimethylphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(c3ccc(C)c(C)c3)=C(N3CCC(C)CC3)C2=O)cc1 |
| InChI | InChI=1S/C28H35N3O2/c1-6-29(7-2)23-10-12-24(13-11-23)31-27(32)25(22-9-8-20(4)21(5)18-22)26(28(31)33)30-16-14-19(3)15-17-30/h8-13,18-19H,6-7,14-17H2,1-5H3 |
| InChIKey | FHXKTKFQNCZAAW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|