C25H29ClN4O2 — CID 110569107
3-(4-chlorophenyl)-1-[4-(diethylamino)phenyl]-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110569107) has the molecular formula C25H29ClN4O2 and a molecular weight of 452.99 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[4-(diethylamino)phenyl]-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-1-[4-(diethylamino)phenyl]-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110569107 |
| Molecular Formula | C25H29ClN4O2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[4-(diethylamino)phenyl]-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(c3ccc(Cl)cc3)=C(N3CCN(C)CC3)C2=O)cc1 |
| InChI | InChI=1S/C25H29ClN4O2/c1-4-28(5-2)20-10-12-21(13-11-20)30-24(31)22(18-6-8-19(26)9-7-18)23(25(30)32)29-16-14-27(3)15-17-29/h6-13H,4-5,14-17H2,1-3H3 |
| InChIKey | IYJZTWQTQYYNEY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|