C17H22O3 — CID 11054878
(1R,2S,7R,10S)-2-methyltetracyclo[10.3.1.01,10.02,7]hexadecane-4,6,13-trione (PubChem CID 11054878) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (1R,2S,7R,10S)-2-methyltetracyclo[10.3.1.01,10.02,7]hexadecane-4,6,13-trione.
| Compound Name | (1R,2S,7R,10S)-2-methyltetracyclo[10.3.1.01,10.02,7]hexadecane-4,6,13-trione |
|---|---|
| PubChem CID | 11054878 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (1R,2S,7R,10S)-2-methyltetracyclo[10.3.1.01,10.02,7]hexadecane-4,6,13-trione |
| SMILES | C[C@]12CC(=O)CC(=O)[C@@H]1CC[C@H]1CC3C[C@]12CCC3=O |
| InChI | InChI=1S/C17H22O3/c1-16-9-12(18)7-15(20)13(16)3-2-11-6-10-8-17(11,16)5-4-14(10)19/h10-11,13H,2-9H2,1H3/t10?,11-,13-,16-,17+/m0/s1 |
| InChIKey | DYHUQRKYMAPECS-VLDWGRKISA-N |
| XLogP | 2.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|