C18H24O3 — CID 11781200
(1R,2S,7R,10S)-6-methoxy-2-methyltetracyclo[10.3.1.01,10.02,7]hexadec-5-ene-4,13-dione (PubChem CID 11781200) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (1R,2S,7R,10S)-6-methoxy-2-methyltetracyclo[10.3.1.01,10.02,7]hexadec-5-ene-4,13-dione.
| Compound Name | (1R,2S,7R,10S)-6-methoxy-2-methyltetracyclo[10.3.1.01,10.02,7]hexadec-5-ene-4,13-dione |
|---|---|
| PubChem CID | 11781200 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (1R,2S,7R,10S)-6-methoxy-2-methyltetracyclo[10.3.1.01,10.02,7]hexadec-5-ene-4,13-dione |
| SMILES | COC1=CC(=O)C[C@@]2(C)[C@H]1CC[C@H]1CC3C[C@]12CCC3=O |
| InChI | InChI=1S/C18H24O3/c1-17-10-13(19)8-16(21-2)14(17)4-3-12-7-11-9-18(12,17)6-5-15(11)20/h8,11-12,14H,3-7,9-10H2,1-2H3/t11?,12-,14-,17-,18+/m0/s1 |
| InChIKey | ONMIZPLUCNWPJK-NYAQFSEWSA-N |
| XLogP | 3.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |