C8H11FO2 — CID 14326953
4-fluoro-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 14326953) has the molecular formula C8H11FO2 and a molecular weight of 158.17 g/mol. Its IUPAC name is 4-fluoro-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 4-fluoro-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 14326953 |
| Molecular Formula | C8H11FO2 |
| Molecular Weight | 158.17 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 4-fluoro-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)CC(=O)C1F |
| InChI | InChI=1S/C8H11FO2/c1-8(2)4-5(10)3-6(11)7(8)9/h7H,3-4H2,1-2H3 |
| InChIKey | MFANSHFPAVQCEL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|