C17H22N2O3S — CID 110553814
3-(2,6-dimethylmorpholin-4-yl)-1-propan-2-yl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553814) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-1-propan-2-yl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-1-propan-2-yl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553814 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-1-propan-2-yl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CC1CN(C2=C(c3cccs3)C(=O)N(C(C)C)C2=O)CC(C)O1 |
| InChI | InChI=1S/C17H22N2O3S/c1-10(2)19-16(20)14(13-6-5-7-23-13)15(17(19)21)18-8-11(3)22-12(4)9-18/h5-7,10-12H,8-9H2,1-4H3 |
| InChIKey | RXHARACXSLWZTJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|