C9H22INO2 — CID 11055790
[(4R,5S)-4,5-dihydroxyhexyl]-trimethylazanium iodide (PubChem CID 11055790) has the molecular formula C9H22INO2 and a molecular weight of 303.18 g/mol. Its IUPAC name is [(4R,5S)-4,5-dihydroxyhexyl]-trimethylazanium iodide.
| Compound Name | [(4R,5S)-4,5-dihydroxyhexyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 11055790 |
| Molecular Formula | C9H22INO2 |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [(4R,5S)-4,5-dihydroxyhexyl]-trimethylazanium iodide |
| SMILES | C[C@H](O)[C@H](O)CCC[N+](C)(C)C.[I-] |
| InChI | InChI=1S/C9H22NO2.HI/c1-8(11)9(12)6-5-7-10(2,3)4;/h8-9,11-12H,5-7H2,1-4H3;1H/q+1;/p-1/t8-,9+;/m0./s1 |
| InChIKey | WMEOULNIFMPPLW-OULXEKPRSA-M |
| XLogP | -2.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|