C14H29ClN2O4 — CID 171379586
[(4S,5S)-5-carboxy-5-(2,2-dimethylpropanoylamino)-4-hydroxypentyl]-trimethylazanium chloride (PubChem CID 171379586) has the molecular formula C14H29ClN2O4 and a molecular weight of 324.85 g/mol. Its IUPAC name is [(4S,5S)-5-carboxy-5-(2,2-dimethylpropanoylamino)-4-hydroxypentyl]-trimethylazanium chloride.
| Compound Name | [(4S,5S)-5-carboxy-5-(2,2-dimethylpropanoylamino)-4-hydroxypentyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 171379586 |
| Molecular Formula | C14H29ClN2O4 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | [(4S,5S)-5-carboxy-5-(2,2-dimethylpropanoylamino)-4-hydroxypentyl]-trimethylazanium chloride |
| SMILES | CC(C)(C)C(=O)N[C@H](C(=O)O)[C@@H](O)CCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C14H28N2O4.ClH/c1-14(2,3)13(20)15-11(12(18)19)10(17)8-7-9-16(4,5)6;/h10-11,17H,7-9H2,1-6H3,(H-,15,18,19,20);1H/t10-,11-;/m0./s1 |
| InChIKey | CLMMVQPIOQDTGD-ACMTZBLWSA-N |
| XLogP | -2.55 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|