C17H36O2Si2 — CID 11056563
tert-butyl-[(1S,2R,6S)-2,6-dimethyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane (PubChem CID 11056563) has the molecular formula C17H36O2Si2 and a molecular weight of 328.65 g/mol. Its IUPAC name is tert-butyl-[(1S,2R,6S)-2,6-dimethyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R,6S)-2,6-dimethyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11056563 |
| Molecular Formula | C17H36O2Si2 |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | tert-butyl-[(1S,2R,6S)-2,6-dimethyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane |
| SMILES | C[C@@H]1C=C(O[Si](C)(C)C)C[C@H](C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O2Si2/c1-13-11-15(18-20(6,7)8)12-14(2)16(13)19-21(9,10)17(3,4)5/h11,13-14,16H,12H2,1-10H3/t13-,14+,16-/m1/s1 |
| InChIKey | ULGUVMWYWWUGLP-IJEWVQPXSA-N |
| XLogP | 5.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|