C21H22Cl2N2O5 — CID 110567972
3-[bis(2-methoxyethyl)amino]-4-(2,4-dichlorophenyl)-1-(furan-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110567972) has the molecular formula C21H22Cl2N2O5 and a molecular weight of 453.32 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)amino]-4-(2,4-dichlorophenyl)-1-(furan-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-[bis(2-methoxyethyl)amino]-4-(2,4-dichlorophenyl)-1-(furan-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110567972 |
| Molecular Formula | C21H22Cl2N2O5 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 3-[bis(2-methoxyethyl)amino]-4-(2,4-dichlorophenyl)-1-(furan-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | COCCN(CCOC)C1=C(c2ccc(Cl)cc2Cl)C(=O)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C21H22Cl2N2O5/c1-28-10-7-24(8-11-29-2)19-18(16-6-5-14(22)12-17(16)23)20(26)25(21(19)27)13-15-4-3-9-30-15/h3-6,9,12H,7-8,10-11,13H2,1-2H3 |
| InChIKey | VQMOQWZCUOEFTJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|