C21H44O2Si2 — CID 11058109
(1S,2R,5S)-2,4-dimethyl-5-trimethylsilyl-2-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-ol (PubChem CID 11058109) has the molecular formula C21H44O2Si2 and a molecular weight of 384.75 g/mol. Its IUPAC name is (1S,2R,5S)-2,4-dimethyl-5-trimethylsilyl-2-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-ol.
| Compound Name | (1S,2R,5S)-2,4-dimethyl-5-trimethylsilyl-2-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 11058109 |
| Molecular Formula | C21H44O2Si2 |
| Molecular Weight | 384.75 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | (1S,2R,5S)-2,4-dimethyl-5-trimethylsilyl-2-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-ol |
| SMILES | CC1=C[C@](C)(CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O)C[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C21H44O2Si2/c1-15(2)25(16(3)4,17(5)6)23-14-21(8)13-18(7)19(12-20(21)22)24(9,10)11/h13,15-17,19-20,22H,12,14H2,1-11H3/t19-,20-,21+/m0/s1 |
| InChIKey | DEQSDZLVNADUJJ-PCCBWWKXSA-N |
| XLogP | 6.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|