C18H13FN2O4 — CID 110581350
N-[4-[1-(3-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-3-yl]phenyl]acetamide (PubChem CID 110581350) has the molecular formula C18H13FN2O4 and a molecular weight of 340.31 g/mol. Its IUPAC name is N-[4-[1-(3-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[1-(3-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110581350 |
| Molecular Formula | C18H13FN2O4 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-[4-[1-(3-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(O)C(=O)N(c3cccc(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C18H13FN2O4/c1-10(22)20-13-7-5-11(6-8-13)15-16(23)18(25)21(17(15)24)14-4-2-3-12(19)9-14/h2-9,23H,1H3,(H,20,22) |
| InChIKey | UTYPRZYYCCWBTM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|