C19H13F3N2O4 — CID 110581405
N-[4-[4-hydroxy-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]phenyl]acetamide (PubChem CID 110581405) has the molecular formula C19H13F3N2O4 and a molecular weight of 390.32 g/mol. Its IUPAC name is N-[4-[4-hydroxy-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-hydroxy-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110581405 |
| Molecular Formula | C19H13F3N2O4 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-[4-[4-hydroxy-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(O)C(=O)N(c3ccc(C(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H13F3N2O4/c1-10(25)23-13-6-2-11(3-7-13)15-16(26)18(28)24(17(15)27)14-8-4-12(5-9-14)19(20,21)22/h2-9,26H,1H3,(H,23,25) |
| InChIKey | WFDUCPWBFDUKSR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|