C18H16CrO7 — CID 11058364
carbon monoxide;[[6-(cyclopenten-1-yl)-2-oxabicyclo[3.2.0]hept-6-en-7-yl]-methoxymethylidene]chromium (PubChem CID 11058364) has the molecular formula C18H16CrO7 and a molecular weight of 396.32 g/mol. Its IUPAC name is carbon monoxide;[[6-(cyclopenten-1-yl)-2-oxabicyclo[3.2.0]hept-6-en-7-yl]-methoxymethylidene]chromium.
| Compound Name | carbon monoxide;[[6-(cyclopenten-1-yl)-2-oxabicyclo[3.2.0]hept-6-en-7-yl]-methoxymethylidene]chromium |
|---|---|
| PubChem CID | 11058364 |
| Molecular Formula | C18H16CrO7 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | carbon monoxide;[[6-(cyclopenten-1-yl)-2-oxabicyclo[3.2.0]hept-6-en-7-yl]-methoxymethylidene]chromium |
| SMILES | COC(=[Cr])C1=C(C2=CCCC2)C2CCOC12.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C13H16O2.5CO.Cr/c1-14-8-11-12(9-4-2-3-5-9)10-6-7-15-13(10)11;5*1-2;/h4,10,13H,2-3,5-7H2,1H3;;;;;; |
| InChIKey | HWGYNXABUQJBRS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 117.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|