C24H34O — CID 143368889
4-[(1Z)-buta-1,3-dienyl]-2-butan-2-yl-8-ethenyl-5,6-dimethyl-7-[(Z)-prop-1-enyl]-3,3a,6,8a-tetrahydro-2H-cyclohepta[b]furan (PubChem CID 143368889) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-2-butan-2-yl-8-ethenyl-5,6-dimethyl-7-[(Z)-prop-1-enyl]-3,3a,6,8a-tetrahydro-2H-cyclohepta[b]furan.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-2-butan-2-yl-8-ethenyl-5,6-dimethyl-7-[(Z)-prop-1-enyl]-3,3a,6,8a-tetrahydro-2H-cyclohepta[b]furan |
|---|---|
| PubChem CID | 143368889 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-2-butan-2-yl-8-ethenyl-5,6-dimethyl-7-[(Z)-prop-1-enyl]-3,3a,6,8a-tetrahydro-2H-cyclohepta[b]furan |
| SMILES | C=C/C=C\C1=C(C)C(C)C(/C=C\C)=C(C=C)C2OC(C(C)CC)CC12 |
| InChI | InChI=1S/C24H34O/c1-8-12-14-21-18(7)17(6)20(13-9-2)19(11-4)24-22(21)15-23(25-24)16(5)10-3/h8-9,11-14,16-17,22-24H,1,4,10,15H2,2-3,5-7H3/b13-9-,14-12- |
| InChIKey | SQFBWKUDGRVWCX-YKCZHJISSA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|