C19H18CrO7 — CID 134884838
carbon monoxide;[[7-(cyclopenten-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]chromium (PubChem CID 134884838) has the molecular formula C19H18CrO7 and a molecular weight of 410.34 g/mol. Its IUPAC name is carbon monoxide;[[7-(cyclopenten-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]chromium.
| Compound Name | carbon monoxide;[[7-(cyclopenten-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]chromium |
|---|---|
| PubChem CID | 134884838 |
| Molecular Formula | C19H18CrO7 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | carbon monoxide;[[7-(cyclopenten-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]chromium |
| SMILES | COC(=[Cr])C1=C(C2=CCCC2)C2CCCOC12.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C14H18O2.5CO.Cr/c1-15-9-12-13(10-5-2-3-6-10)11-7-4-8-16-14(11)12;5*1-2;/h5,11,14H,2-4,6-8H2,1H3;;;;;; |
| InChIKey | QEEHMXCWSUGOJR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 117.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|