C21H22CrO8 — CID 11102473
carbon monoxide;[methoxy-[7-[(E)-4-prop-2-enoxybut-2-en-2-yl]-2-oxabicyclo[4.2.0]oct-7-en-8-yl]methylidene]chromium (PubChem CID 11102473) has the molecular formula C21H22CrO8 and a molecular weight of 454.40 g/mol. Its IUPAC name is carbon monoxide;[methoxy-[7-[(E)-4-prop-2-enoxybut-2-en-2-yl]-2-oxabicyclo[4.2.0]oct-7-en-8-yl]methylidene]chromium.
| Compound Name | carbon monoxide;[methoxy-[7-[(E)-4-prop-2-enoxybut-2-en-2-yl]-2-oxabicyclo[4.2.0]oct-7-en-8-yl]methylidene]chromium |
|---|---|
| PubChem CID | 11102473 |
| Molecular Formula | C21H22CrO8 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | carbon monoxide;[methoxy-[7-[(E)-4-prop-2-enoxybut-2-en-2-yl]-2-oxabicyclo[4.2.0]oct-7-en-8-yl]methylidene]chromium |
| SMILES | C=CCOC/C=C(\C)C1=C(C(=[Cr])OC)C2OCCCC12.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C16H22O3.5CO.Cr/c1-4-8-18-10-7-12(2)15-13-6-5-9-19-16(13)14(15)11-17-3;5*1-2;/h4,7,13,16H,1,5-6,8-10H2,2-3H3;;;;;;/b12-7+;;;;;; |
| InChIKey | OYOPQKSFEVLZRW-BAVTXHHUSA-N |
| XLogP | 2.38 |
| TPSA | 127.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|