C17H30O — CID 145231683
2,4-dimethyl-6-[(3E,5Z)-octa-1,3,5-trien-3-yl]oxane;ethane (PubChem CID 145231683) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 2,4-dimethyl-6-[(3E,5Z)-octa-1,3,5-trien-3-yl]oxane;ethane.
| Compound Name | 2,4-dimethyl-6-[(3E,5Z)-octa-1,3,5-trien-3-yl]oxane;ethane |
|---|---|
| PubChem CID | 145231683 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 2,4-dimethyl-6-[(3E,5Z)-octa-1,3,5-trien-3-yl]oxane;ethane |
| SMILES | C=C/C(=C\C=C/CC)C1CC(C)CC(C)O1.CC |
| InChI | InChI=1S/C15H24O.C2H6/c1-5-7-8-9-14(6-2)15-11-12(3)10-13(4)16-15;1-2/h6-9,12-13,15H,2,5,10-11H2,1,3-4H3;1-2H3/b8-7-,14-9+; |
| InChIKey | DNWIYDYJWCVTJV-AENWIXSNSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|