C13H12ClNO2 — CID 110584858
3-chloro-4-(2,4-dimethylphenyl)-1-methylpyrrole-2,5-dione (PubChem CID 110584858) has the molecular formula C13H12ClNO2 and a molecular weight of 249.70 g/mol. Its IUPAC name is 3-chloro-4-(2,4-dimethylphenyl)-1-methylpyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(2,4-dimethylphenyl)-1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110584858 |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-chloro-4-(2,4-dimethylphenyl)-1-methylpyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(Cl)C(=O)N(C)C2=O)c(C)c1 |
| InChI | InChI=1S/C13H12ClNO2/c1-7-4-5-9(8(2)6-7)10-11(14)13(17)15(3)12(10)16/h4-6H,1-3H3 |
| InChIKey | RHNBIEJCIYNMHR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|