C10H8BrN3O2 — CID 110600708
N-(2-bromophenyl)-5-oxo-1,2-dihydropyrazole-3-carboxamide (PubChem CID 110600708) has the molecular formula C10H8BrN3O2 and a molecular weight of 282.10 g/mol. Its IUPAC name is N-(2-bromophenyl)-5-oxo-1,2-dihydropyrazole-3-carboxamide.
| Compound Name | N-(2-bromophenyl)-5-oxo-1,2-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110600708 |
| Molecular Formula | C10H8BrN3O2 |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | N-(2-bromophenyl)-5-oxo-1,2-dihydropyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)c1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C10H8BrN3O2/c11-6-3-1-2-4-7(6)12-10(16)8-5-9(15)14-13-8/h1-5H,(H,12,16)(H2,13,14,15) |
| InChIKey | WJZFTVINSBONOX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |