C28H32FN3O4S — CID 11060436
1-[ethyl-(4-fluorobenzoyl)amino]-1-methyl-3-(4-methylphenyl)sulfonyl-3-(4-phenylbutyl)urea (PubChem CID 11060436) has the molecular formula C28H32FN3O4S and a molecular weight of 525.65 g/mol. Its IUPAC name is 1-[ethyl-(4-fluorobenzoyl)amino]-1-methyl-3-(4-methylphenyl)sulfonyl-3-(4-phenylbutyl)urea.
| Compound Name | 1-[ethyl-(4-fluorobenzoyl)amino]-1-methyl-3-(4-methylphenyl)sulfonyl-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 11060436 |
| Molecular Formula | C28H32FN3O4S |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 1-[ethyl-(4-fluorobenzoyl)amino]-1-methyl-3-(4-methylphenyl)sulfonyl-3-(4-phenylbutyl)urea |
| SMILES | CCN(C(=O)c1ccc(F)cc1)N(C)C(=O)N(CCCCc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H32FN3O4S/c1-4-31(27(33)24-15-17-25(29)18-16-24)30(3)28(34)32(21-9-8-12-23-10-6-5-7-11-23)37(35,36)26-19-13-22(2)14-20-26/h5-7,10-11,13-20H,4,8-9,12,21H2,1-3H3 |
| InChIKey | QAWVSQOCMXAXEB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|