C23H19FN2O2 — CID 110606102
N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-fluoro-5-phenylbenzamide (PubChem CID 110606102) has the molecular formula C23H19FN2O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-fluoro-5-phenylbenzamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-fluoro-5-phenylbenzamide |
|---|---|
| PubChem CID | 110606102 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-fluoro-5-phenylbenzamide |
| SMILES | O=C(NCC(=O)N1CCc2ccccc21)c1cc(-c2ccccc2)ccc1F |
| InChI | InChI=1S/C23H19FN2O2/c24-20-11-10-18(16-6-2-1-3-7-16)14-19(20)23(28)25-15-22(27)26-13-12-17-8-4-5-9-21(17)26/h1-11,14H,12-13,15H2,(H,25,28) |
| InChIKey | DLUPPOCOWOAMKC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |