C20H16N2O4 — CID 110673380
N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-oxochromene-3-carboxamide (PubChem CID 110673380) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 110673380 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCC(=O)N1CCc2ccccc21)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C20H16N2O4/c23-18(22-10-9-13-5-1-3-7-16(13)22)12-21-19(24)15-11-14-6-2-4-8-17(14)26-20(15)25/h1-8,11H,9-10,12H2,(H,21,24) |
| InChIKey | LDUBNCPKDNVVJV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|