C20H21NO5S — CID 110607710
3-[2-(2,5-dimethylbenzoyl)pyrrolidin-1-yl]sulfonylbenzoic acid (PubChem CID 110607710) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-[2-(2,5-dimethylbenzoyl)pyrrolidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 3-[2-(2,5-dimethylbenzoyl)pyrrolidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 110607710 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[2-(2,5-dimethylbenzoyl)pyrrolidin-1-yl]sulfonylbenzoic acid |
| SMILES | Cc1ccc(C)c(C(=O)C2CCCN2S(=O)(=O)c2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C20H21NO5S/c1-13-8-9-14(2)17(11-13)19(22)18-7-4-10-21(18)27(25,26)16-6-3-5-15(12-16)20(23)24/h3,5-6,8-9,11-12,18H,4,7,10H2,1-2H3,(H,23,24) |
| InChIKey | IJRSQEVUFPWGHG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |