C30H25INPPd — CID 11061345
(6E)-6-cyclohexa-2,4-dien-1-ylidenecyclohexa-2,4-dien-1-imine;iodopalladium(1+);triphenylphosphane (PubChem CID 11061345) has the molecular formula C30H25INPPd and a molecular weight of 663.84 g/mol. Its IUPAC name is (6E)-6-cyclohexa-2,4-dien-1-ylidenecyclohexa-2,4-dien-1-imine;iodopalladium(1+);triphenylphosphane.
| Compound Name | (6E)-6-cyclohexa-2,4-dien-1-ylidenecyclohexa-2,4-dien-1-imine;iodopalladium(1+);triphenylphosphane |
|---|---|
| PubChem CID | 11061345 |
| Molecular Formula | C30H25INPPd |
| Molecular Weight | 663.84 g/mol |
| Exact Mass | 662.98 |
| IUPAC Name | (6E)-6-cyclohexa-2,4-dien-1-ylidenecyclohexa-2,4-dien-1-imine;iodopalladium(1+);triphenylphosphane |
| SMILES | [H]/N=C1\C=CC=C\C1=C1/C=CC=C[CH-]1.[Pd+]I.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C12H10N.HI.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;/h1-15H;1-9,13H;1H;/q;-1;;+2/p-1/b;13-12+;; |
| InChIKey | AHXAWNZLOLKXMH-QLYCOYKZSA-M |
| XLogP | 7.09 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.84 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|