About iodocopper;triphenylphosphane
iodocopper;triphenylphosphane (PubChem CID 12549340) has the molecular formula C18H15CuIP
and a molecular weight of 452.74 g/mol. Its IUPAC name is iodocopper;triphenylphosphane.
Molecular Properties
| Compound Name | iodocopper;triphenylphosphane |
| PubChem CID | 12549340 |
| Molecular Formula | C18H15CuIP |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 451.93 |
| IUPAC Name | iodocopper;triphenylphosphane |
| SMILES | [Cu]I.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.Cu.HI/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;;1H/q;+1;/p-1 |
| InChIKey | DKGJFOQMRCRRSL-UHFFFAOYSA-M |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze iodocopper;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodocopper;triphenylphosphane?
The IUPAC name of iodocopper;triphenylphosphane (CID 12549340) is iodocopper;triphenylphosphane.
What is the SMILES notation for iodocopper;triphenylphosphane?
The canonical SMILES for iodocopper;triphenylphosphane is [Cu]I.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of iodocopper;triphenylphosphane?
The InChIKey is DKGJFOQMRCRRSL-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15P.Cu.HI/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;;1H/q;+1;/p-1.
What are the key properties of iodocopper;triphenylphosphane?
iodocopper;triphenylphosphane has a molecular weight of 452.74 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iodocopper;triphenylphosphane is sourced from PubChem (CID 12549340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).