C19H23N5O — CID 110617839
N-(4,4-dimethylpentyl)-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide (PubChem CID 110617839) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide.
| Compound Name | N-(4,4-dimethylpentyl)-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide |
|---|---|
| PubChem CID | 110617839 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-(4,4-dimethylpentyl)-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide |
| SMILES | CC(C)(C)CCCNC(=O)c1ccc(-c2nnc3ncccn23)cc1 |
| InChI | InChI=1S/C19H23N5O/c1-19(2,3)10-4-11-20-17(25)15-8-6-14(7-9-15)16-22-23-18-21-12-5-13-24(16)18/h5-9,12-13H,4,10-11H2,1-3H3,(H,20,25) |
| InChIKey | AGCXFNOQEAWHOV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|