C20H26N6O2 — CID 110618549
N-[2-[2-(diethylamino)ethoxy]ethyl]-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide (PubChem CID 110618549) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is N-[2-[2-(diethylamino)ethoxy]ethyl]-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide.
| Compound Name | N-[2-[2-(diethylamino)ethoxy]ethyl]-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide |
|---|---|
| PubChem CID | 110618549 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-[2-[2-(diethylamino)ethoxy]ethyl]-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide |
| SMILES | CCN(CC)CCOCCNC(=O)c1ccc(-c2nnc3ncccn23)cc1 |
| InChI | InChI=1S/C20H26N6O2/c1-3-25(4-2)13-15-28-14-11-21-19(27)17-8-6-16(7-9-17)18-23-24-20-22-10-5-12-26(18)20/h5-10,12H,3-4,11,13-15H2,1-2H3,(H,21,27) |
| InChIKey | ZCUKUIXCCHADOU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|