C21H19N5O2 — CID 110618114
N-[3-(4-hydroxyphenyl)propyl]-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide (PubChem CID 110618114) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is N-[3-(4-hydroxyphenyl)propyl]-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide.
| Compound Name | N-[3-(4-hydroxyphenyl)propyl]-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide |
|---|---|
| PubChem CID | 110618114 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[3-(4-hydroxyphenyl)propyl]-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide |
| SMILES | O=C(NCCCc1ccc(O)cc1)c1ccc(-c2nnc3ncccn23)cc1 |
| InChI | InChI=1S/C21H19N5O2/c27-18-10-4-15(5-11-18)3-1-12-22-20(28)17-8-6-16(7-9-17)19-24-25-21-23-13-2-14-26(19)21/h2,4-11,13-14,27H,1,3,12H2,(H,22,28) |
| InChIKey | OSIKWADTXCAJJT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|