C14H17N3O2S2 — CID 110628985
N-(cyclopentylsulfamoyl)-4-(1,3-thiazol-2-yl)aniline (PubChem CID 110628985) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-(cyclopentylsulfamoyl)-4-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-(cyclopentylsulfamoyl)-4-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 110628985 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-(cyclopentylsulfamoyl)-4-(1,3-thiazol-2-yl)aniline |
| SMILES | O=S(=O)(Nc1ccc(-c2nccs2)cc1)NC1CCCC1 |
| InChI | InChI=1S/C14H17N3O2S2/c18-21(19,16-12-3-1-2-4-12)17-13-7-5-11(6-8-13)14-15-9-10-20-14/h5-10,12,16-17H,1-4H2 |
| InChIKey | UPGWVWMWZLWZNW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |