C16H20N2S — CID 80705391
N-(3,3-dimethylcyclopentyl)-4-(1,3-thiazol-2-yl)aniline (PubChem CID 80705391) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-4-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-(3,3-dimethylcyclopentyl)-4-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 80705391 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-4-(1,3-thiazol-2-yl)aniline |
| SMILES | CC1(C)CCC(Nc2ccc(-c3nccs3)cc2)C1 |
| InChI | InChI=1S/C16H20N2S/c1-16(2)8-7-14(11-16)18-13-5-3-12(4-6-13)15-17-9-10-19-15/h3-6,9-10,14,18H,7-8,11H2,1-2H3 |
| InChIKey | YPZMCOQCVXSJST-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |