C15H13N5O3S2 — CID 110634809
N-[5-[(6-phenyl-3-pyridinyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110634809) has the molecular formula C15H13N5O3S2 and a molecular weight of 375.44 g/mol. Its IUPAC name is N-[5-[(6-phenyl-3-pyridinyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(6-phenyl-3-pyridinyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110634809 |
| Molecular Formula | C15H13N5O3S2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[5-[(6-phenyl-3-pyridinyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)Nc2ccc(-c3ccccc3)nc2)s1 |
| InChI | InChI=1S/C15H13N5O3S2/c1-10(21)17-14-18-19-15(24-14)25(22,23)20-12-7-8-13(16-9-12)11-5-3-2-4-6-11/h2-9,20H,1H3,(H,17,18,21) |
| InChIKey | MLQSSHYOUHCLCL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|