C11H11N5O4S2 — CID 171714660
N-[5-[[(E)-(2-hydroxyphenyl)methylideneamino]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 171714660) has the molecular formula C11H11N5O4S2 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[5-[[(E)-(2-hydroxyphenyl)methylideneamino]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[[(E)-(2-hydroxyphenyl)methylideneamino]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 171714660 |
| Molecular Formula | C11H11N5O4S2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-[5-[[(E)-(2-hydroxyphenyl)methylideneamino]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)N/N=C/c2ccccc2O)s1 |
| InChI | InChI=1S/C11H11N5O4S2/c1-7(17)13-10-14-15-11(21-10)22(19,20)16-12-6-8-4-2-3-5-9(8)18/h2-6,16,18H,1H3,(H,13,14,17)/b12-6+ |
| InChIKey | SXFJHBVWQOYEFV-WUXMJOGZSA-N |
| XLogP | 0.51 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|