About N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide
N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide (PubChem CID 11065773) has the molecular formula C16H14N4O
and a molecular weight of 278.32 g/mol. Its IUPAC name is N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide.
Molecular Properties
| Compound Name | N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide |
| PubChem CID | 11065773 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide |
| SMILES | CC(=O)/C(=N\c1ccccc1)NNc1ccccc1C#N |
| InChI | InChI=1S/C16H14N4O/c1-12(21)16(18-14-8-3-2-4-9-14)20-19-15-10-6-5-7-13(15)11-17/h2-10,19H,1H3,(H,18,20) |
| InChIKey | JEQXCIXGMLJKOA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide?
The IUPAC name of N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide (CID 11065773) is N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide.
What is the SMILES notation for N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide?
The canonical SMILES for N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide is CC(=O)/C(=N\c1ccccc1)NNc1ccccc1C#N.
What is the InChIKey of N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide?
The InChIKey is JEQXCIXGMLJKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O/c1-12(21)16(18-14-8-3-2-4-9-14)20-19-15-10-6-5-7-13(15)11-17/h2-10,19H,1H3,(H,18,20).
What are the key properties of N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide?
N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide has a molecular weight of 278.32 g/mol, XLogP of 2.79, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoanilino)-2-oxo-N'-phenylpropanimidamide is sourced from PubChem (CID 11065773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).