C22H26ClN3S — CID 110659945
7-tert-butyl-N-(2-chloro-4,6-dimethylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 110659945) has the molecular formula C22H26ClN3S and a molecular weight of 399.99 g/mol. Its IUPAC name is 7-tert-butyl-N-(2-chloro-4,6-dimethylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-tert-butyl-N-(2-chloro-4,6-dimethylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110659945 |
| Molecular Formula | C22H26ClN3S |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 7-tert-butyl-N-(2-chloro-4,6-dimethylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc(C)c(Nc2ncnc3sc4c(c23)CCC(C(C)(C)C)C4)c(Cl)c1 |
| InChI | InChI=1S/C22H26ClN3S/c1-12-8-13(2)19(16(23)9-12)26-20-18-15-7-6-14(22(3,4)5)10-17(15)27-21(18)25-11-24-20/h8-9,11,14H,6-7,10H2,1-5H3,(H,24,25,26) |
| InChIKey | JXXFDCYEIILEPH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |