C21H22N4S2 — CID 21012087
[4-[(7-tert-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]phenyl] thiocyanate (PubChem CID 21012087) has the molecular formula C21H22N4S2 and a molecular weight of 394.57 g/mol. Its IUPAC name is [4-[(7-tert-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]phenyl] thiocyanate.
| Compound Name | [4-[(7-tert-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 21012087 |
| Molecular Formula | C21H22N4S2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [4-[(7-tert-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]phenyl] thiocyanate |
| SMILES | CC(C)(C)C1CCc2c(sc3ncnc(Nc4ccc(SC#N)cc4)c23)C1 |
| InChI | InChI=1S/C21H22N4S2/c1-21(2,3)13-4-9-16-17(10-13)27-20-18(16)19(23-12-24-20)25-14-5-7-15(8-6-14)26-11-22/h5-8,12-13H,4,9-10H2,1-3H3,(H,23,24,25) |
| InChIKey | YUTJZSDDPHJSAV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|