C20H22IN3S — CID 21010129
7-tert-butyl-N-(4-iodophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 21010129) has the molecular formula C20H22IN3S and a molecular weight of 463.39 g/mol. Its IUPAC name is 7-tert-butyl-N-(4-iodophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-tert-butyl-N-(4-iodophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21010129 |
| Molecular Formula | C20H22IN3S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 7-tert-butyl-N-(4-iodophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)C1CCc2c(sc3ncnc(Nc4ccc(I)cc4)c23)C1 |
| InChI | InChI=1S/C20H22IN3S/c1-20(2,3)12-4-9-15-16(10-12)25-19-17(15)18(22-11-23-19)24-14-7-5-13(21)6-8-14/h5-8,11-12H,4,9-10H2,1-3H3,(H,22,23,24) |
| InChIKey | YMSYHIPESFPYBM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|