C26H35N3OS — CID 21012229
7-tert-butyl-N-(4-hexoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 21012229) has the molecular formula C26H35N3OS and a molecular weight of 437.65 g/mol. Its IUPAC name is 7-tert-butyl-N-(4-hexoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-tert-butyl-N-(4-hexoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21012229 |
| Molecular Formula | C26H35N3OS |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 7-tert-butyl-N-(4-hexoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCCCOc1ccc(Nc2ncnc3sc4c(c23)CCC(C(C)(C)C)C4)cc1 |
| InChI | InChI=1S/C26H35N3OS/c1-5-6-7-8-15-30-20-12-10-19(11-13-20)29-24-23-21-14-9-18(26(2,3)4)16-22(21)31-25(23)28-17-27-24/h10-13,17-18H,5-9,14-16H2,1-4H3,(H,27,28,29) |
| InChIKey | NKQCWCILVNOGQS-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|