C21H30N2O3 — CID 110678516
benzyl 3-(2,6-dimethylpiperidine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 110678516) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is benzyl 3-(2,6-dimethylpiperidine-1-carbonyl)piperidine-1-carboxylate.
| Compound Name | benzyl 3-(2,6-dimethylpiperidine-1-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110678516 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | benzyl 3-(2,6-dimethylpiperidine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | CC1CCCC(C)N1C(=O)C1CCCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H30N2O3/c1-16-8-6-9-17(2)23(16)20(24)19-12-7-13-22(14-19)21(25)26-15-18-10-4-3-5-11-18/h3-5,10-11,16-17,19H,6-9,12-15H2,1-2H3 |
| InChIKey | ZKUCNGUVHGWKKO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |