C19H38O4Si2 — CID 11069114
2-trimethylsilylethyl (E,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-oxohex-4-enoate (PubChem CID 11069114) has the molecular formula C19H38O4Si2 and a molecular weight of 386.68 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-oxohex-4-enoate.
| Compound Name | 2-trimethylsilylethyl (E,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-oxohex-4-enoate |
|---|---|
| PubChem CID | 11069114 |
| Molecular Formula | C19H38O4Si2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-trimethylsilylethyl (E,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-oxohex-4-enoate |
| SMILES | C/C(=C\C=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C19H38O4Si2/c1-15(11-12-20)17(23-25(9,10)19(3,4)5)16(2)18(21)22-13-14-24(6,7)8/h11-12,16-17H,13-14H2,1-10H3/b15-11+/t16-,17-/m0/s1 |
| InChIKey | IQQOYLXTMJTGJW-JBAYFQIUSA-N |
| XLogP | 5.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|