C16H12Cl2N2O2 — CID 110694719
N-(3,4-dichlorophenyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide (PubChem CID 110694719) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide |
|---|---|
| PubChem CID | 110694719 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide |
| SMILES | O=C(CC1C(=O)Nc2ccccc21)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O2/c17-12-6-5-9(7-13(12)18)19-15(21)8-11-10-3-1-2-4-14(10)20-16(11)22/h1-7,11H,8H2,(H,19,21)(H,20,22) |
| InChIKey | CDCRTNQQALWESX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |