C16H13Cl2N3O2 — CID 166231644
N'-(2,4-dichlorophenyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetohydrazide (PubChem CID 166231644) has the molecular formula C16H13Cl2N3O2 and a molecular weight of 350.21 g/mol. Its IUPAC name is N'-(2,4-dichlorophenyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetohydrazide.
| Compound Name | N'-(2,4-dichlorophenyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 166231644 |
| Molecular Formula | C16H13Cl2N3O2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | N'-(2,4-dichlorophenyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetohydrazide |
| SMILES | O=C(CC1C(=O)Nc2ccccc21)NNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2N3O2/c17-9-5-6-14(12(18)7-9)20-21-15(22)8-11-10-3-1-2-4-13(10)19-16(11)23/h1-7,11,20H,8H2,(H,19,23)(H,21,22) |
| InChIKey | CEFLKVJEZCFTKQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|